C12H13N3O2 — CID 3567443
3-nitro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazole (PubChem CID 3567443) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-nitro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazole.
| Compound Name | 3-nitro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 3567443 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-nitro-7,8,9,10-tetrahydro-6H-azepino[1,2-a]benzimidazole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)nc1n2CCCCC1 |
| InChI | InChI=1S/C12H13N3O2/c16-15(17)9-5-6-11-10(8-9)13-12-4-2-1-3-7-14(11)12/h5-6,8H,1-4,7H2 |
| InChIKey | QNZVMYVXYISBET-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|