C21H21ClN4O3S — CID 3567509
4-(4-chlorophenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 3567509) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | 4-(4-chlorophenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 3567509 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(2,4-dimethoxyphenyl)methylideneamino]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)C2=C(C)NC(=S)NC2c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C21H21ClN4O3S/c1-12-18(19(25-21(30)24-12)13-4-7-15(22)8-5-13)20(27)26-23-11-14-6-9-16(28-2)10-17(14)29-3/h4-11,19H,1-3H3,(H,26,27)(H2,24,25,30) |
| InChIKey | UKYKPZLIQWYLTQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|