C9H7F7N2OS — CID 3567599
N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 3567599) has the molecular formula C9H7F7N2OS and a molecular weight of 324.22 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 3567599 |
| Molecular Formula | C9H7F7N2OS |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | Cc1nc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)sc1C |
| InChI | InChI=1S/C9H7F7N2OS/c1-3-4(2)20-6(17-3)18-5(19)7(10,11)8(12,13)9(14,15)16/h1-2H3,(H,17,18,19) |
| InChIKey | ZTGOZNIFVLBMBG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|