C18H14FN3O6S2 — CID 3568040
N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzenesulfonamide (PubChem CID 3568040) has the molecular formula C18H14FN3O6S2 and a molecular weight of 451.46 g/mol. Its IUPAC name is N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3568040 |
| Molecular Formula | C18H14FN3O6S2 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | N-[2-[5-[(4-fluorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-2-nitrobenzenesulfonamide |
| SMILES | O=C1SC(=Cc2ccc(F)cc2)C(=O)N1CCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14FN3O6S2/c19-13-7-5-12(6-8-13)11-15-17(23)21(18(24)29-15)10-9-20-30(27,28)16-4-2-1-3-14(16)22(25)26/h1-8,11,20H,9-10H2 |
| InChIKey | CXGSVMWFLLYSRC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|