About 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium
3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium (PubChem CID 3568732) has the molecular formula C7H7N3O7
and a molecular weight of 245.15 g/mol. Its IUPAC name is 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium.
Molecular Properties
| Compound Name | 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium |
| PubChem CID | 3568732 |
| Molecular Formula | C7H7N3O7 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium |
| SMILES | COc1cc(OC)c([N+](=O)[O-])[n+]([O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7N3O7/c1-16-4-3-5(17-2)7(10(14)15)8(11)6(4)9(12)13/h3H,1-2H3 |
| InChIKey | UUMMQMPPSRPJKK-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 131.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium?
The IUPAC name of 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium (CID 3568732) is 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium.
What is the SMILES notation for 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium?
The canonical SMILES for 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium is COc1cc(OC)c([N+](=O)[O-])[n+]([O-])c1[N+](=O)[O-].
What is the InChIKey of 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium?
The InChIKey is UUMMQMPPSRPJKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O7/c1-16-4-3-5(17-2)7(10(14)15)8(11)6(4)9(12)13/h3H,1-2H3.
What are the key properties of 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium?
3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium has a molecular weight of 245.15 g/mol, XLogP of 0.15, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethoxy-2,6-dinitro-1-oxidopyridin-1-ium is sourced from PubChem (CID 3568732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).