About N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide
N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide (PubChem CID 3569124) has the molecular formula C16H17F2N3O3S
and a molecular weight of 369.39 g/mol. Its IUPAC name is N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide |
| PubChem CID | 3569124 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide |
| SMILES | COc1cc(OC)nc(CSCCNC(=O)c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C16H17F2N3O3S/c1-23-13-8-14(24-2)21-12(20-13)9-25-7-6-19-16(22)15-10(17)4-3-5-11(15)18/h3-5,8H,6-7,9H2,1-2H3,(H,19,22) |
| InChIKey | IZZBBRHLXVASPE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide?
The IUPAC name of N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide (CID 3569124) is N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide.
What is the SMILES notation for N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide?
The canonical SMILES for N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide is COc1cc(OC)nc(CSCCNC(=O)c2c(F)cccc2F)n1.
What is the InChIKey of N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide?
The InChIKey is IZZBBRHLXVASPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O3S/c1-23-13-8-14(24-2)21-12(20-13)9-25-7-6-19-16(22)15-10(17)4-3-5-11(15)18/h3-5,8H,6-7,9H2,1-2H3,(H,19,22).
What are the key properties of N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide?
N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide has a molecular weight of 369.39 g/mol, XLogP of 2.44, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(4,6-dimethoxypyrimidin-2-yl)methylsulfanyl]ethyl]-2,6-difluorobenzamide is sourced from PubChem (CID 3569124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).