C32H27N3O3 — CID 3569950
1'-benzyl-1-ethyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione (PubChem CID 3569950) has the molecular formula C32H27N3O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1'-benzyl-1-ethyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione.
| Compound Name | 1'-benzyl-1-ethyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 3569950 |
| Molecular Formula | C32H27N3O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 1'-benzyl-1-ethyl-5-naphthalen-1-ylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-2',4,6-trione |
| SMILES | CCC1NC2(C(=O)N(Cc3ccccc3)c3ccccc32)C2C(=O)N(c3cccc4ccccc34)C(=O)C12 |
| InChI | InChI=1S/C32H27N3O3/c1-2-24-27-28(30(37)35(29(27)36)25-18-10-14-21-13-6-7-15-22(21)25)32(33-24)23-16-8-9-17-26(23)34(31(32)38)19-20-11-4-3-5-12-20/h3-18,24,27-28,33H,2,19H2,1H3 |
| InChIKey | USOOSUCQAHQJJY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|