C11H15N — CID 35700262
(3R)-3,5-dimethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 35700262) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (3R)-3,5-dimethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (3R)-3,5-dimethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 35700262 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3R)-3,5-dimethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1cccc2c1C[C@@H](C)NC2 |
| InChI | InChI=1S/C11H15N/c1-8-4-3-5-10-7-12-9(2)6-11(8)10/h3-5,9,12H,6-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | JEDGYFXHKLWMCA-SECBINFHSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |