C15H17N3O2S — CID 3570397
6-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one (PubChem CID 3570397) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 6-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 3570397 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 6-[2-(butan-2-ylamino)-1,3-thiazol-4-yl]-4H-1,4-benzoxazin-3-one |
| SMILES | CCC(C)Nc1nc(-c2ccc3c(c2)NC(=O)CO3)cs1 |
| InChI | InChI=1S/C15H17N3O2S/c1-3-9(2)16-15-18-12(8-21-15)10-4-5-13-11(6-10)17-14(19)7-20-13/h4-6,8-9H,3,7H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | UFHWZNRPXNLHAW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |