C13H15N3OS — CID 3571196
2-benzylsulfanyl-5-pyrrolidin-2-yl-1,3,4-oxadiazole (PubChem CID 3571196) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-benzylsulfanyl-5-pyrrolidin-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-benzylsulfanyl-5-pyrrolidin-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3571196 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-benzylsulfanyl-5-pyrrolidin-2-yl-1,3,4-oxadiazole |
| SMILES | c1ccc(CSc2nnc(C3CCCN3)o2)cc1 |
| InChI | InChI=1S/C13H15N3OS/c1-2-5-10(6-3-1)9-18-13-16-15-12(17-13)11-7-4-8-14-11/h1-3,5-6,11,14H,4,7-9H2 |
| InChIKey | OIUXDNFIIPLWDV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |