C21H23FN4O2S2 — CID 3571232
N-[1-(4-ethyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-2-phenylethyl]-4-fluorobenzenesulfonamide (PubChem CID 3571232) has the molecular formula C21H23FN4O2S2 and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[1-(4-ethyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-2-phenylethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[1-(4-ethyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-2-phenylethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3571232 |
| Molecular Formula | C21H23FN4O2S2 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[1-(4-ethyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-2-phenylethyl]-4-fluorobenzenesulfonamide |
| SMILES | C=CCSc1nnc(C(Cc2ccccc2)NS(=O)(=O)c2ccc(F)cc2)n1CC |
| InChI | InChI=1S/C21H23FN4O2S2/c1-3-14-29-21-24-23-20(26(21)4-2)19(15-16-8-6-5-7-9-16)25-30(27,28)18-12-10-17(22)11-13-18/h3,5-13,19,25H,1,4,14-15H2,2H3 |
| InChIKey | YEMOWHUBOFASBF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|