C30H29ClN2O5 — CID 3571310
4-[(4-chlorophenyl)-hydroxymethylidene]-1-(2-morpholin-4-ylethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 3571310) has the molecular formula C30H29ClN2O5 and a molecular weight of 533.02 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-hydroxymethylidene]-1-(2-morpholin-4-ylethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-1-(2-morpholin-4-ylethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3571310 |
| Molecular Formula | C30H29ClN2O5 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 4-[(4-chlorophenyl)-hydroxymethylidene]-1-(2-morpholin-4-ylethyl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCN2CCOCC2)C(c2ccc(OCc3ccccc3)cc2)C1=C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H29ClN2O5/c31-24-10-6-23(7-11-24)28(34)26-27(33(30(36)29(26)35)15-14-32-16-18-37-19-17-32)22-8-12-25(13-9-22)38-20-21-4-2-1-3-5-21/h1-13,27,34H,14-20H2 |
| InChIKey | SUYYDZQPYNSUMI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|