C18H15F3N4O4S — CID 35713248
2-(1-oxophthalazin-2-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]acetamide (PubChem CID 35713248) has the molecular formula C18H15F3N4O4S and a molecular weight of 440.40 g/mol. Its IUPAC name is 2-(1-oxophthalazin-2-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(1-oxophthalazin-2-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 35713248 |
| Molecular Formula | C18H15F3N4O4S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-(1-oxophthalazin-2-yl)-N-[4-(2,2,2-trifluoroethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Cn1ncc2ccccc2c1=O)Nc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N4O4S/c19-18(20,21)11-23-30(28,29)14-7-5-13(6-8-14)24-16(26)10-25-17(27)15-4-2-1-3-12(15)9-22-25/h1-9,23H,10-11H2,(H,24,26) |
| InChIKey | UPEAWQJIPINIGX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |