About N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide
N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 3571459) has the molecular formula C22H23N3O4
and a molecular weight of 393.44 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
Molecular Properties
| Compound Name | N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| PubChem CID | 3571459 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CC(C(=O)NC(=O)NCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H23N3O4/c1-14(2)12-18(25-20(27)16-10-6-7-11-17(16)21(25)28)19(26)24-22(29)23-13-15-8-4-3-5-9-15/h3-11,14,18H,12-13H2,1-2H3,(H2,23,24,26,29) |
| InChIKey | UANFAVUKWWTYKV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide?
The IUPAC name of N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (CID 3571459) is N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
What is the SMILES notation for N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide?
The canonical SMILES for N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide is CC(C)CC(C(=O)NC(=O)NCc1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide?
The InChIKey is UANFAVUKWWTYKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O4/c1-14(2)12-18(25-20(27)16-10-6-7-11-17(16)21(25)28)19(26)24-22(29)23-13-15-8-4-3-5-9-15/h3-11,14,18H,12-13H2,1-2H3,(H2,23,24,26,29).
What are the key properties of N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide?
N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide has a molecular weight of 393.44 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(benzylcarbamoyl)-2-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide is sourced from PubChem (CID 3571459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).