C17H12BrF2NO4 — CID 35716358
[2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate (PubChem CID 35716358) has the molecular formula C17H12BrF2NO4 and a molecular weight of 412.19 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 35716358 |
| Molecular Formula | C17H12BrF2NO4 |
| Molecular Weight | 412.19 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 2-[(4-bromobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)OCC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H12BrF2NO4/c18-12-4-1-10(2-5-12)17(24)21-8-16(23)25-9-15(22)11-3-6-13(19)14(20)7-11/h1-7H,8-9H2,(H,21,24) |
| InChIKey | RIOMIKSWUOYJCG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.19 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |