About N-Acetyl-D-Galactosamine
N-Acetyl-D-Galactosamine (PubChem CID 35717) has the molecular formula C8H15NO6
and a molecular weight of 221.21 g/mol. Its IUPAC name is N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
Molecular Properties
| Compound Name | N-Acetyl-D-Galactosamine |
| PubChem CID | 35717 |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](OC1O)CO)O)O |
| InChI | InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8?/m1/s1 |
| InChIKey | OVRNDRQMDRJTHS-KEWYIRBNSA-N |
| XLogP | -1.70 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 235 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-Acetyl-D-Galactosamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-Acetyl-D-Galactosamine?
The IUPAC name of N-Acetyl-D-Galactosamine (CID 35717) is N-[(3R,4R,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
What is the SMILES notation for N-Acetyl-D-Galactosamine?
The canonical SMILES for N-Acetyl-D-Galactosamine is CC(=O)N[C@@H]1[C@H]([C@H]([C@H](OC1O)CO)O)O.
What is the InChIKey of N-Acetyl-D-Galactosamine?
The InChIKey is OVRNDRQMDRJTHS-KEWYIRBNSA-N. The full InChI is InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6+,7-,8?/m1/s1.
What are the key properties of N-Acetyl-D-Galactosamine?
N-Acetyl-D-Galactosamine has a molecular weight of 221.21 g/mol, XLogP of -1.70, 2 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-Acetyl-D-Galactosamine is sourced from PubChem (CID 35717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).