About 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione
3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione (PubChem CID 3571734) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 3571734 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione |
| SMILES | CCN1CCN(c2cc(=O)n(C3CCCCC3)c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C16H26N4O2/c1-2-18-8-10-19(11-9-18)14-12-15(21)20(16(22)17-14)13-6-4-3-5-7-13/h12-13H,2-11H2,1H3,(H,17,22) |
| InChIKey | LPOLGRFDIFKGEE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione (CID 3571734) is 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione is CCN1CCN(c2cc(=O)n(C3CCCCC3)c(=O)[nH]2)CC1.
What is the InChIKey of 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione?
The InChIKey is LPOLGRFDIFKGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-2-18-8-10-19(11-9-18)14-12-15(21)20(16(22)17-14)13-6-4-3-5-7-13/h12-13H,2-11H2,1H3,(H,17,22).
What are the key properties of 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione?
3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione has a molecular weight of 306.41 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-6-(4-ethylpiperazin-1-yl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3571734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).