C26H30N2O3 — CID 3571746
[4-[2-(3-aminophenyl)-6-[[benzyl(methyl)amino]methyl]-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 3571746) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is [4-[2-(3-aminophenyl)-6-[[benzyl(methyl)amino]methyl]-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[2-(3-aminophenyl)-6-[[benzyl(methyl)amino]methyl]-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 3571746 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | [4-[2-(3-aminophenyl)-6-[[benzyl(methyl)amino]methyl]-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | CN(Cc1ccccc1)CC1CC(c2ccc(CO)cc2)OC(c2cccc(N)c2)O1 |
| InChI | InChI=1S/C26H30N2O3/c1-28(16-19-6-3-2-4-7-19)17-24-15-25(21-12-10-20(18-29)11-13-21)31-26(30-24)22-8-5-9-23(27)14-22/h2-14,24-26,29H,15-18,27H2,1H3 |
| InChIKey | AZOLEJFZCLVFPD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|