C14H13F6N5O — CID 3572318
6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 3572318) has the molecular formula C14H13F6N5O and a molecular weight of 381.28 g/mol. Its IUPAC name is 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3572318 |
| Molecular Formula | C14H13F6N5O |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-methyl-2-N-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccc(C)cc2)nc(OC(C(F)(F)F)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H13F6N5O/c1-7-3-5-8(6-4-7)22-11-23-10(21-2)24-12(25-11)26-9(13(15,16)17)14(18,19)20/h3-6,9H,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | HELPQXXBPUFPBM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |