C20H19Cl2N3O2S2 — CID 3572376
N-(2,6-dichlorophenyl)-2-[(3-ethyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 3572376) has the molecular formula C20H19Cl2N3O2S2 and a molecular weight of 468.43 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[(3-ethyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,6-dichlorophenyl)-2-[(3-ethyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3572376 |
| Molecular Formula | C20H19Cl2N3O2S2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[(3-ethyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2c(Cl)cccc2Cl)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C20H19Cl2N3O2S2/c1-2-25-19(27)16-11-6-3-4-9-14(11)29-18(16)24-20(25)28-10-15(26)23-17-12(21)7-5-8-13(17)22/h5,7-8H,2-4,6,9-10H2,1H3,(H,23,26) |
| InChIKey | QCFZNVQNQQKBJY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |