About 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol
5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol (PubChem CID 3572630) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol.
Molecular Properties
| Compound Name | 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol |
| PubChem CID | 3572630 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol |
| SMILES | Cc1ccc(C2CC3CC2C(C)C3(C)C)c(O)c1 |
| InChI | InChI=1S/C17H24O/c1-10-5-6-13(16(18)7-10)15-9-12-8-14(15)11(2)17(12,3)4/h5-7,11-12,14-15,18H,8-9H2,1-4H3 |
| InChIKey | GAFLGZGJEOWWEJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol?
The IUPAC name of 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol (CID 3572630) is 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol.
What is the SMILES notation for 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol?
The canonical SMILES for 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol is Cc1ccc(C2CC3CC2C(C)C3(C)C)c(O)c1.
What is the InChIKey of 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol?
The InChIKey is GAFLGZGJEOWWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c1-10-5-6-13(16(18)7-10)15-9-12-8-14(15)11(2)17(12,3)4/h5-7,11-12,14-15,18H,8-9H2,1-4H3.
What are the key properties of 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol?
5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol has a molecular weight of 244.38 g/mol, XLogP of 4.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(5,5,6-trimethyl-2-bicyclo[2.2.1]heptanyl)phenol is sourced from PubChem (CID 3572630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).