C21H21N3O6 — CID 3572672
methyl 1-(4,5-dimethoxy-2-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 3572672) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is methyl 1-(4,5-dimethoxy-2-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(4,5-dimethoxy-2-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 3572672 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | methyl 1-(4,5-dimethoxy-2-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C(c2cc(OC)c(OC)cc2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C21H21N3O6/c1-28-17-9-13(16(24(26)27)10-18(17)29-2)20-19-12(8-15(23-20)21(25)30-3)11-6-4-5-7-14(11)22-19/h4-7,9-10,15,20,22-23H,8H2,1-3H3 |
| InChIKey | XAQRFBBEIXTAME-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|