C27H24ClNO7 — CID 3572810
[2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 3572810) has the molecular formula C27H24ClNO7 and a molecular weight of 509.94 g/mol. Its IUPAC name is [2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3572810 |
| Molecular Formula | C27H24ClNO7 |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | [2-(2-benzoyl-4-chloroanilino)-2-oxoethyl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(=O)Nc2ccc(Cl)cc2C(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H24ClNO7/c1-33-22-13-17(14-23(34-2)27(22)35-3)9-12-25(31)36-16-24(30)29-21-11-10-19(28)15-20(21)26(32)18-7-5-4-6-8-18/h4-15H,16H2,1-3H3,(H,29,30) |
| InChIKey | USKYCYSHYRUKNQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|