About N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide
N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide (PubChem CID 3572888) has the molecular formula C6H6BrN3O2S
and a molecular weight of 264.10 g/mol. Its IUPAC name is N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide.
Molecular Properties
| Compound Name | N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide |
| PubChem CID | 3572888 |
| Molecular Formula | C6H6BrN3O2S |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 262.94 |
| IUPAC Name | N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide |
| SMILES | CNC(=O)C(=O)Nc1ncc(Br)s1 |
| InChI | InChI=1S/C6H6BrN3O2S/c1-8-4(11)5(12)10-6-9-2-3(7)13-6/h2H,1H3,(H,8,11)(H,9,10,12) |
| InChIKey | ZPAWAILKKSAGFD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide?
The IUPAC name of N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide (CID 3572888) is N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide.
What is the SMILES notation for N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide?
The canonical SMILES for N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide is CNC(=O)C(=O)Nc1ncc(Br)s1.
What is the InChIKey of N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide?
The InChIKey is ZPAWAILKKSAGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN3O2S/c1-8-4(11)5(12)10-6-9-2-3(7)13-6/h2H,1H3,(H,8,11)(H,9,10,12).
What are the key properties of N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide?
N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide has a molecular weight of 264.10 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-bromo-1,3-thiazol-2-yl)-N-methyloxamide is sourced from PubChem (CID 3572888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).