C13H18N3S+ — CID 3573237
[amino-[(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methylsulfanyl]methylidene]azanium (PubChem CID 3573237) has the molecular formula C13H18N3S+ and a molecular weight of 248.38 g/mol. Its IUPAC name is [amino-[(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methylsulfanyl]methylidene]azanium.
| Compound Name | [amino-[(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methylsulfanyl]methylidene]azanium |
|---|---|
| PubChem CID | 3573237 |
| Molecular Formula | C13H18N3S+ |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [amino-[(3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)methylsulfanyl]methylidene]azanium |
| SMILES | CC1(C)Cc2ccccc2C(=CSC(N)=[NH2+])N1 |
| InChI | InChI=1S/C13H17N3S/c1-13(2)7-9-5-3-4-6-10(9)11(16-13)8-17-12(14)15/h3-6,8,16H,7H2,1-2H3,(H3,14,15)/p+1 |
| InChIKey | RKYSHDIYKYNOQB-UHFFFAOYSA-O |
| XLogP | 0.72 |
| TPSA | 63.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|