C21H19NO5 — CID 35738639
6,7,8,9-tetrahydrodibenzofuran-2-yl 3-(2-amino-2-oxoethoxy)benzoate (PubChem CID 35738639) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is 6,7,8,9-tetrahydrodibenzofuran-2-yl 3-(2-amino-2-oxoethoxy)benzoate.
| Compound Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 3-(2-amino-2-oxoethoxy)benzoate |
|---|---|
| PubChem CID | 35738639 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 6,7,8,9-tetrahydrodibenzofuran-2-yl 3-(2-amino-2-oxoethoxy)benzoate |
| SMILES | NC(=O)COc1cccc(C(=O)Oc2ccc3oc4c(c3c2)CCCC4)c1 |
| InChI | InChI=1S/C21H19NO5/c22-20(23)12-25-14-5-3-4-13(10-14)21(24)26-15-8-9-19-17(11-15)16-6-1-2-7-18(16)27-19/h3-5,8-11H,1-2,6-7,12H2,(H2,22,23) |
| InChIKey | MDCZVVVLAHLOSR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|