C22H33N3O2S2 — CID 3573959
(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbamodithioate (PubChem CID 3573959) has the molecular formula C22H33N3O2S2 and a molecular weight of 435.66 g/mol. Its IUPAC name is (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbamodithioate.
| Compound Name | (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbamodithioate |
|---|---|
| PubChem CID | 3573959 |
| Molecular Formula | C22H33N3O2S2 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | (1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)methyl N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]carbamodithioate |
| SMILES | CC12CCC(CC1=NNC(=S)SCN1C(=O)C3CCC(C)(C1=O)C3(C)C)C2(C)C |
| InChI | InChI=1S/C22H33N3O2S2/c1-19(2)13-7-9-21(19,5)15(11-13)23-24-18(28)29-12-25-16(26)14-8-10-22(6,17(25)27)20(14,3)4/h13-14H,7-12H2,1-6H3,(H,24,28) |
| InChIKey | MDQFLKKSNLJIQV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|