About N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide
N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide (PubChem CID 3574419) has the molecular formula C20H14N2OS2
and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide |
| PubChem CID | 3574419 |
| Molecular Formula | C20H14N2OS2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2csc(-c3ccccc3)n2)c1)c1cccs1 |
| InChI | InChI=1S/C20H14N2OS2/c23-19(18-10-5-11-24-18)21-16-9-4-8-15(12-16)17-13-25-20(22-17)14-6-2-1-3-7-14/h1-13H,(H,21,23) |
| InChIKey | IYYXLBPJIUPROM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide?
The IUPAC name of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide (CID 3574419) is N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide.
What is the SMILES notation for N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide?
The canonical SMILES for N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide is O=C(Nc1cccc(-c2csc(-c3ccccc3)n2)c1)c1cccs1.
What is the InChIKey of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide?
The InChIKey is IYYXLBPJIUPROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2OS2/c23-19(18-10-5-11-24-18)21-16-9-4-8-15(12-16)17-13-25-20(22-17)14-6-2-1-3-7-14/h1-13H,(H,21,23).
What are the key properties of N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide?
N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide has a molecular weight of 362.48 g/mol, XLogP of 5.79, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-phenyl-1,3-thiazol-4-yl)phenyl]thiophene-2-carboxamide is sourced from PubChem (CID 3574419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).