About 2-oxobut-3-enyl acetate
2-oxobut-3-enyl acetate (PubChem CID 3574547) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-oxobut-3-enyl acetate.
Molecular Properties
| Compound Name | 2-oxobut-3-enyl acetate |
| PubChem CID | 3574547 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | 2-oxobut-3-enyl acetate |
| SMILES | C=CC(=O)COC(C)=O |
| InChI | InChI=1S/C6H8O3/c1-3-6(8)4-9-5(2)7/h3H,1,4H2,2H3 |
| InChIKey | GZNCCNHJQSRXNU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxobut-3-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxobut-3-enyl acetate?
The IUPAC name of 2-oxobut-3-enyl acetate (CID 3574547) is 2-oxobut-3-enyl acetate.
What is the SMILES notation for 2-oxobut-3-enyl acetate?
The canonical SMILES for 2-oxobut-3-enyl acetate is C=CC(=O)COC(C)=O.
What is the InChIKey of 2-oxobut-3-enyl acetate?
The InChIKey is GZNCCNHJQSRXNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-3-6(8)4-9-5(2)7/h3H,1,4H2,2H3.
What are the key properties of 2-oxobut-3-enyl acetate?
2-oxobut-3-enyl acetate has a molecular weight of 128.13 g/mol, XLogP of 0.30, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxobut-3-enyl acetate is sourced from PubChem (CID 3574547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).