About (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid
(Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid (PubChem CID 35752897) has the molecular formula C12H10N2O4
and a molecular weight of 246.22 g/mol. Its IUPAC name is (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid.
Molecular Properties
| Compound Name | (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid |
| PubChem CID | 35752897 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccco1)c1nnc(C2CC2)o1 |
| InChI | InChI=1S/C12H10N2O4/c15-12(16)9(6-8-2-1-5-17-8)11-14-13-10(18-11)7-3-4-7/h1-2,5-7H,3-4H2,(H,15,16)/b9-6- |
| InChIKey | IWRIRADCJLYKMB-TWGQIWQCSA-N |
| XLogP | 2.17 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid?
The IUPAC name of (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid (CID 35752897) is (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid.
What is the SMILES notation for (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid?
The canonical SMILES for (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid is O=C(O)/C(=C\c1ccco1)c1nnc(C2CC2)o1.
What is the InChIKey of (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid?
The InChIKey is IWRIRADCJLYKMB-TWGQIWQCSA-N. The full InChI is InChI=1S/C12H10N2O4/c15-12(16)9(6-8-2-1-5-17-8)11-14-13-10(18-11)7-3-4-7/h1-2,5-7H,3-4H2,(H,15,16)/b9-6-.
What are the key properties of (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid?
(Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid has a molecular weight of 246.22 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(5-cyclopropyl-1,3,4-oxadiazol-2-yl)-3-(furan-2-yl)prop-2-enoic acid is sourced from PubChem (CID 35752897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).