About [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine
[4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine (PubChem CID 35754994) has the molecular formula C12H17N5O
and a molecular weight of 247.30 g/mol. Its IUPAC name is [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine.
Molecular Properties
| Compound Name | [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine |
| PubChem CID | 35754994 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine |
| SMILES | Cc1ccc(OCCc2nnc(NN)n2C)cc1 |
| InChI | InChI=1S/C12H17N5O/c1-9-3-5-10(6-4-9)18-8-7-11-15-16-12(14-13)17(11)2/h3-6H,7-8,13H2,1-2H3,(H,14,16) |
| InChIKey | WMVHULSSIRECCS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine?
The IUPAC name of [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine (CID 35754994) is [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine.
What is the SMILES notation for [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine?
The canonical SMILES for [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine is Cc1ccc(OCCc2nnc(NN)n2C)cc1.
What is the InChIKey of [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine?
The InChIKey is WMVHULSSIRECCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O/c1-9-3-5-10(6-4-9)18-8-7-11-15-16-12(14-13)17(11)2/h3-6H,7-8,13H2,1-2H3,(H,14,16).
What are the key properties of [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine?
[4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine has a molecular weight of 247.30 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-5-[2-(4-methylphenoxy)ethyl]-1,2,4-triazol-3-yl]hydrazine is sourced from PubChem (CID 35754994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).