About N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide
N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide (PubChem CID 35755059) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide.
Molecular Properties
| Compound Name | N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide |
| PubChem CID | 35755059 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide |
| SMILES | CCOc1ccc(N2CCCN=C2NC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O3/c1-3-26-18-11-7-16(8-12-18)23-14-4-13-21-20(23)22-19(24)15-5-9-17(25-2)10-6-15/h5-12H,3-4,13-14H2,1-2H3,(H,21,22,24) |
| InChIKey | CPIRULLOWTVBRD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide?
The IUPAC name of N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide (CID 35755059) is N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide.
What is the SMILES notation for N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide?
The canonical SMILES for N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide is CCOc1ccc(N2CCCN=C2NC(=O)c2ccc(OC)cc2)cc1.
What is the InChIKey of N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide?
The InChIKey is CPIRULLOWTVBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-3-26-18-11-7-16(8-12-18)23-14-4-13-21-20(23)22-19(24)15-5-9-17(25-2)10-6-15/h5-12H,3-4,13-14H2,1-2H3,(H,21,22,24).
What are the key properties of N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide?
N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide has a molecular weight of 353.42 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-ethoxyphenyl)-5,6-dihydro-4H-pyrimidin-2-yl]-4-methoxybenzamide is sourced from PubChem (CID 35755059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).