C17H17N5O2S — CID 35755183
4-amino-3-benzylsulfanyl-6-(4-methoxyanilino)-1,2,4-triazin-5-one (PubChem CID 35755183) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-amino-3-benzylsulfanyl-6-(4-methoxyanilino)-1,2,4-triazin-5-one.
| Compound Name | 4-amino-3-benzylsulfanyl-6-(4-methoxyanilino)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 35755183 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-amino-3-benzylsulfanyl-6-(4-methoxyanilino)-1,2,4-triazin-5-one |
| SMILES | COc1ccc(Nc2nnc(SCc3ccccc3)n(N)c2=O)cc1 |
| InChI | InChI=1S/C17H17N5O2S/c1-24-14-9-7-13(8-10-14)19-15-16(23)22(18)17(21-20-15)25-11-12-5-3-2-4-6-12/h2-10H,11,18H2,1H3,(H,19,20) |
| InChIKey | CMYUWQGLEUBHLY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |