C16H23N7S — CID 35758483
N-prop-2-enyl-4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbothioamide (PubChem CID 35758483) has the molecular formula C16H23N7S and a molecular weight of 345.48 g/mol. Its IUPAC name is N-prop-2-enyl-4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbothioamide.
| Compound Name | N-prop-2-enyl-4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 35758483 |
| Molecular Formula | C16H23N7S |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-prop-2-enyl-4-(1,3,5-trimethylpyrazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN(c2nc(C)nc3c(C)nn(C)c23)CC1 |
| InChI | InChI=1S/C16H23N7S/c1-5-6-17-16(24)23-9-7-22(8-10-23)15-14-13(18-12(3)19-15)11(2)20-21(14)4/h5H,1,6-10H2,2-4H3,(H,17,24) |
| InChIKey | CGEXMWFOOWHKMW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|