C16H14N2O — CID 3576033
5,5a,6,11-tetrahydroisoquinolino[3,2-b]quinazolin-13-one (PubChem CID 3576033) has the molecular formula C16H14N2O and a molecular weight of 250.30 g/mol. Its IUPAC name is 5,5a,6,11-tetrahydroisoquinolino[3,2-b]quinazolin-13-one.
| Compound Name | 5,5a,6,11-tetrahydroisoquinolino[3,2-b]quinazolin-13-one |
|---|---|
| PubChem CID | 3576033 |
| Molecular Formula | C16H14N2O |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 5,5a,6,11-tetrahydroisoquinolino[3,2-b]quinazolin-13-one |
| SMILES | O=C1c2ccccc2NC2Cc3ccccc3CN12 |
| InChI | InChI=1S/C16H14N2O/c19-16-13-7-3-4-8-14(13)17-15-9-11-5-1-2-6-12(11)10-18(15)16/h1-8,15,17H,9-10H2 |
| InChIKey | SBKOMJJZYQZCEU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |