C11H12N2OS — CID 35766151
2-ethylsulfanyl-5-(4-methylphenyl)-1,3,4-oxadiazole (PubChem CID 35766151) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-(4-methylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-ethylsulfanyl-5-(4-methylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 35766151 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-ethylsulfanyl-5-(4-methylphenyl)-1,3,4-oxadiazole |
| SMILES | CCSc1nnc(-c2ccc(C)cc2)o1 |
| InChI | InChI=1S/C11H12N2OS/c1-3-15-11-13-12-10(14-11)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3 |
| InChIKey | XUXNAUCHKKTXQH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |