C32H16F8N2O6 — CID 3576681
1-[3-[4-[4-[3-(2,5-dioxopyrrolidin-1-yl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]phenyl]pyrrolidine-2,5-dione (PubChem CID 3576681) has the molecular formula C32H16F8N2O6 and a molecular weight of 676.47 g/mol. Its IUPAC name is 1-[3-[4-[4-[3-(2,5-dioxopyrrolidin-1-yl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[4-[4-[3-(2,5-dioxopyrrolidin-1-yl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3576681 |
| Molecular Formula | C32H16F8N2O6 |
| Molecular Weight | 676.47 g/mol |
| Exact Mass | 676.09 |
| IUPAC Name | 1-[3-[4-[4-[3-(2,5-dioxopyrrolidin-1-yl)phenoxy]-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorophenoxy]phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1cccc(Oc2c(F)c(F)c(-c3c(F)c(F)c(Oc4cccc(N5C(=O)CCC5=O)c4)c(F)c3F)c(F)c2F)c1 |
| InChI | InChI=1S/C32H16F8N2O6/c33-23-21(24(34)28(38)31(27(23)37)47-15-5-1-3-13(11-15)41-17(43)7-8-18(41)44)22-25(35)29(39)32(30(40)26(22)36)48-16-6-2-4-14(12-16)42-19(45)9-10-20(42)46/h1-6,11-12H,7-10H2 |
| InChIKey | RALQZFCSFBBPKG-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.47 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|