C17H10F5N5O3S — CID 3576817
2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzamide (PubChem CID 3576817) has the molecular formula C17H10F5N5O3S and a molecular weight of 459.36 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzamide |
|---|---|
| PubChem CID | 3576817 |
| Molecular Formula | C17H10F5N5O3S |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-(4-sulfamoylanilino)pyrimidin-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ccnc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C17H10F5N5O3S/c18-11-10(12(19)14(21)15(22)13(11)20)16(28)27-17-24-6-5-9(26-17)25-7-1-3-8(4-2-7)31(23,29)30/h1-6H,(H2,23,29,30)(H2,24,25,26,27,28) |
| InChIKey | BYXYWDVAUCLHPP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|