C14H17F3N2O4S — CID 3577153
2-acetamido-4-methylsulfonyl-N-[3-(trifluoromethyl)phenyl]butanamide (PubChem CID 3577153) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is 2-acetamido-4-methylsulfonyl-N-[3-(trifluoromethyl)phenyl]butanamide.
| Compound Name | 2-acetamido-4-methylsulfonyl-N-[3-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 3577153 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-acetamido-4-methylsulfonyl-N-[3-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(=O)NC(CCS(C)(=O)=O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O4S/c1-9(20)18-12(6-7-24(2,22)23)13(21)19-11-5-3-4-10(8-11)14(15,16)17/h3-5,8,12H,6-7H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | UGQNYDZRHCSSGZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |