C24H23N3O2S2 — CID 35772636
2-(3-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-phenylpropyl)acetamide (PubChem CID 35772636) has the molecular formula C24H23N3O2S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-(3-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(3-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 35772636 |
| Molecular Formula | C24H23N3O2S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-(3-methyl-4-oxo-6-phenylthieno[2,3-d]pyrimidin-2-yl)sulfanyl-N-(3-phenylpropyl)acetamide |
| SMILES | Cn1c(SCC(=O)NCCCc2ccccc2)nc2sc(-c3ccccc3)cc2c1=O |
| InChI | InChI=1S/C24H23N3O2S2/c1-27-23(29)19-15-20(18-12-6-3-7-13-18)31-22(19)26-24(27)30-16-21(28)25-14-8-11-17-9-4-2-5-10-17/h2-7,9-10,12-13,15H,8,11,14,16H2,1H3,(H,25,28) |
| InChIKey | APDZSDLTYUBIAM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|