About 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline
4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline (PubChem CID 3577590) has the molecular formula C19H15BrN2
and a molecular weight of 351.25 g/mol. Its IUPAC name is 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline.
Molecular Properties
| Compound Name | 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline |
| PubChem CID | 3577590 |
| Molecular Formula | C19H15BrN2 |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline |
| SMILES | Nc1ccc(Br)cc1/C(=N/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H15BrN2/c20-15-11-12-18(21)17(13-15)19(14-7-3-1-4-8-14)22-16-9-5-2-6-10-16/h1-13H,21H2/b22-19+ |
| InChIKey | JABUATWODHZAHR-ZBJSNUHESA-N |
| XLogP | 5.20 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline?
The IUPAC name of 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline (CID 3577590) is 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline.
What is the SMILES notation for 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline?
The canonical SMILES for 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline is Nc1ccc(Br)cc1/C(=N/c1ccccc1)c1ccccc1.
What is the InChIKey of 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline?
The InChIKey is JABUATWODHZAHR-ZBJSNUHESA-N. The full InChI is InChI=1S/C19H15BrN2/c20-15-11-12-18(21)17(13-15)19(14-7-3-1-4-8-14)22-16-9-5-2-6-10-16/h1-13H,21H2/b22-19+.
What are the key properties of 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline?
4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline has a molecular weight of 351.25 g/mol, XLogP of 5.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(C,N-diphenylcarbonimidoyl)aniline is sourced from PubChem (CID 3577590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).