About Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl-
Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl- (PubChem CID 357776) has the molecular formula C12H26Si2
and a molecular weight of 226.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3-trimethylsilylprop-2-ynyl)silane.
Molecular Properties
| Compound Name | Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl- |
| PubChem CID | 357776 |
| Molecular Formula | C12H26Si2 |
| Molecular Weight | 226.50 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | tert-butyl-dimethyl-(3-trimethylsilylprop-2-ynyl)silane |
| SMILES | CC(C)(C)[Si](C)(C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C12H26Si2/c1-12(2,3)14(7,8)11-9-10-13(4,5)6/h11H2,1-8H3 |
| InChIKey | MZLUBGIGGWMLSJ-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | 250 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl-?
The IUPAC name of Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl- (CID 357776) is tert-butyl-dimethyl-(3-trimethylsilylprop-2-ynyl)silane.
What is the SMILES notation for Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl-?
The canonical SMILES for Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl- is CC(C)(C)[Si](C)(C)CC#C[Si](C)(C)C.
What is the InChIKey of Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl-?
The InChIKey is MZLUBGIGGWMLSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26Si2/c1-12(2,3)14(7,8)11-9-10-13(4,5)6/h11H2,1-8H3.
What are the key properties of Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl-?
Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl- has a molecular weight of 226.50 g/mol, XLogP of not available, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Silane, [3-[(1,1-dimethylethyl)dimethylsilyl]-1-propynyl]trimethyl- is sourced from PubChem (CID 357776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).