C16H15N3O4S — CID 3577910
ethyl 2-(3-methyl-5-phenyl-1,3,4-oxadiazol-2-ylidene)-2-(4-oxo-1,3-thiazol-2-yl)acetate (PubChem CID 3577910) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is ethyl 2-(3-methyl-5-phenyl-1,3,4-oxadiazol-2-ylidene)-2-(4-oxo-1,3-thiazol-2-yl)acetate.
| Compound Name | ethyl 2-(3-methyl-5-phenyl-1,3,4-oxadiazol-2-ylidene)-2-(4-oxo-1,3-thiazol-2-yl)acetate |
|---|---|
| PubChem CID | 3577910 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | ethyl 2-(3-methyl-5-phenyl-1,3,4-oxadiazol-2-ylidene)-2-(4-oxo-1,3-thiazol-2-yl)acetate |
| SMILES | CCOC(=O)C(C1=NC(=O)CS1)=C1OC(c2ccccc2)=NN1C |
| InChI | InChI=1S/C16H15N3O4S/c1-3-22-16(21)12(14-17-11(20)9-24-14)15-19(2)18-13(23-15)10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3 |
| InChIKey | LQUJFEVRIVVWNE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|