C25H16N4O5 — CID 35779220
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-phenylquinoline-4-carboxylate (PubChem CID 35779220) has the molecular formula C25H16N4O5 and a molecular weight of 452.43 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-phenylquinoline-4-carboxylate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 35779220 |
| Molecular Formula | C25H16N4O5 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]methyl 2-phenylquinoline-4-carboxylate |
| SMILES | O=C(OCc1nnc(-c2ccc([N+](=O)[O-])cc2)o1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C25H16N4O5/c30-25(33-15-23-27-28-24(34-23)17-10-12-18(13-11-17)29(31)32)20-14-22(16-6-2-1-3-7-16)26-21-9-5-4-8-19(20)21/h1-14H,15H2 |
| InChIKey | TZRONLPLGOJMMF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 121.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|