C15H16BrN3S — CID 3578009
3-(4-bromophenyl)-1,4,6-triazatricyclo[6.2.2.02,7]dodec-2(7)-ene-5-thione (PubChem CID 3578009) has the molecular formula C15H16BrN3S and a molecular weight of 350.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1,4,6-triazatricyclo[6.2.2.02,7]dodec-2(7)-ene-5-thione.
| Compound Name | 3-(4-bromophenyl)-1,4,6-triazatricyclo[6.2.2.02,7]dodec-2(7)-ene-5-thione |
|---|---|
| PubChem CID | 3578009 |
| Molecular Formula | C15H16BrN3S |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 3-(4-bromophenyl)-1,4,6-triazatricyclo[6.2.2.02,7]dodec-2(7)-ene-5-thione |
| SMILES | S=C1NC2=C(C(c3ccc(Br)cc3)N1)N1CCC2CC1 |
| InChI | InChI=1S/C15H16BrN3S/c16-11-3-1-9(2-4-11)12-14-13(18-15(20)17-12)10-5-7-19(14)8-6-10/h1-4,10,12H,5-8H2,(H2,17,18,20) |
| InChIKey | SEZNDJQIVBIZFH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|