C19H17FN4O — CID 35784561
2-fluoro-6-[[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]benzonitrile (PubChem CID 35784561) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-fluoro-6-[[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]benzonitrile.
| Compound Name | 2-fluoro-6-[[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]benzonitrile |
|---|---|
| PubChem CID | 35784561 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-fluoro-6-[[(R)-(4-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]amino]benzonitrile |
| SMILES | COc1ccc([C@@H](Nc2cccc(F)c2C#N)c2nccn2C)cc1 |
| InChI | InChI=1S/C19H17FN4O/c1-24-11-10-22-19(24)18(13-6-8-14(25-2)9-7-13)23-17-5-3-4-16(20)15(17)12-21/h3-11,18,23H,1-2H3/t18-/m1/s1 |
| InChIKey | IUNFELLGJBSFAI-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |