C18H19BrO4 — CID 3578494
11-(4-bromophenyl)-3,3,9-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione (PubChem CID 3578494) has the molecular formula C18H19BrO4 and a molecular weight of 379.25 g/mol. Its IUPAC name is 11-(4-bromophenyl)-3,3,9-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione.
| Compound Name | 11-(4-bromophenyl)-3,3,9-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione |
|---|---|
| PubChem CID | 3578494 |
| Molecular Formula | C18H19BrO4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 11-(4-bromophenyl)-3,3,9-trimethyl-2,4-dioxaspiro[5.5]undec-8-ene-1,5-dione |
| SMILES | CC1=CCC2(C(=O)OC(C)(C)OC2=O)C(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C18H19BrO4/c1-11-8-9-18(15(20)22-17(2,3)23-16(18)21)14(10-11)12-4-6-13(19)7-5-12/h4-8,14H,9-10H2,1-3H3 |
| InChIKey | GVSJKQWIEGIEBT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|