About 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine
1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine (PubChem CID 3578502) has the molecular formula C18H20ClN5
and a molecular weight of 341.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 3578502 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine |
| SMILES | CC1CC(C)CN(c2ncnc3c2cnn3-c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H20ClN5/c1-12-7-13(2)10-23(9-12)17-16-8-22-24(18(16)21-11-20-17)15-5-3-14(19)4-6-15/h3-6,8,11-13H,7,9-10H2,1-2H3 |
| InChIKey | WTNKZJVGLHPLRW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine (CID 3578502) is 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine is CC1CC(C)CN(c2ncnc3c2cnn3-c2ccc(Cl)cc2)C1.
What is the InChIKey of 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine?
The InChIKey is WTNKZJVGLHPLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClN5/c1-12-7-13(2)10-23(9-12)17-16-8-22-24(18(16)21-11-20-17)15-5-3-14(19)4-6-15/h3-6,8,11-13H,7,9-10H2,1-2H3.
What are the key properties of 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine?
1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine has a molecular weight of 341.85 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-4-(3,5-dimethylpiperidin-1-yl)pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 3578502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).