C17H20N4O3S2 — CID 35785840
1-benzyl-3-[[4-(ethylsulfamoyl)benzoyl]amino]thiourea (PubChem CID 35785840) has the molecular formula C17H20N4O3S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(ethylsulfamoyl)benzoyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[4-(ethylsulfamoyl)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 35785840 |
| Molecular Formula | C17H20N4O3S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-benzyl-3-[[4-(ethylsulfamoyl)benzoyl]amino]thiourea |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)NNC(=S)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N4O3S2/c1-2-19-26(23,24)15-10-8-14(9-11-15)16(22)20-21-17(25)18-12-13-6-4-3-5-7-13/h3-11,19H,2,12H2,1H3,(H,20,22)(H2,18,21,25) |
| InChIKey | UQFBJLHNWMROAD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|