About methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate
methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate (PubChem CID 3578607) has the molecular formula C20H19NO3S
and a molecular weight of 353.44 g/mol. Its IUPAC name is methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate |
| PubChem CID | 3578607 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=C(SC)N(c2ccccc2)C(c2ccccc2)CC1=O |
| InChI | InChI=1S/C20H19NO3S/c1-24-20(23)18-17(22)13-16(14-9-5-3-6-10-14)21(19(18)25-2)15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3 |
| InChIKey | YJQAUBWMXFNMRG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate?
The IUPAC name of methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate (CID 3578607) is methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate.
What is the SMILES notation for methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate?
The canonical SMILES for methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate is COC(=O)C1=C(SC)N(c2ccccc2)C(c2ccccc2)CC1=O.
What is the InChIKey of methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate?
The InChIKey is YJQAUBWMXFNMRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO3S/c1-24-20(23)18-17(22)13-16(14-9-5-3-6-10-14)21(19(18)25-2)15-11-7-4-8-12-15/h3-12,16H,13H2,1-2H3.
What are the key properties of methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate?
methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate has a molecular weight of 353.44 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methylsulfanyl-4-oxo-1,2-diphenyl-2,3-dihydropyridine-5-carboxylate is sourced from PubChem (CID 3578607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).